C16H14N2O2 — CID 150877100
1-(1-aminoethylamino)anthracene-9,10-dione (PubChem CID 150877100) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 1-(1-aminoethylamino)anthracene-9,10-dione.
| Compound Name | 1-(1-aminoethylamino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 150877100 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 1-(1-aminoethylamino)anthracene-9,10-dione |
| SMILES | CC(N)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C16H14N2O2/c1-9(17)18-13-8-4-7-12-14(13)16(20)11-6-3-2-5-10(11)15(12)19/h2-9,18H,17H2,1H3 |
| InChIKey | KVFMUGYRGCXRMZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|