C18H13NO4 — CID 139606526
2-[(9,10-dioxoanthracen-1-yl)amino]but-3-enoic acid (PubChem CID 139606526) has the molecular formula C18H13NO4 and a molecular weight of 307.31 g/mol. Its IUPAC name is 2-[(9,10-dioxoanthracen-1-yl)amino]but-3-enoic acid.
| Compound Name | 2-[(9,10-dioxoanthracen-1-yl)amino]but-3-enoic acid |
|---|---|
| PubChem CID | 139606526 |
| Molecular Formula | C18H13NO4 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 2-[(9,10-dioxoanthracen-1-yl)amino]but-3-enoic acid |
| SMILES | C=CC(Nc1cccc2c1C(=O)c1ccccc1C2=O)C(=O)O |
| InChI | InChI=1S/C18H13NO4/c1-2-13(18(22)23)19-14-9-5-8-12-15(14)17(21)11-7-4-3-6-10(11)16(12)20/h2-9,13,19H,1H2,(H,22,23) |
| InChIKey | FUFWIQKIXMFABP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|