C24H17NO3 — CID 3349653
N-(9,10-dioxoanthracen-1-yl)-2-phenylcyclopropane-1-carboxamide (PubChem CID 3349653) has the molecular formula C24H17NO3 and a molecular weight of 367.40 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-1-yl)-2-phenylcyclopropane-1-carboxamide.
| Compound Name | N-(9,10-dioxoanthracen-1-yl)-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 3349653 |
| Molecular Formula | C24H17NO3 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | N-(9,10-dioxoanthracen-1-yl)-2-phenylcyclopropane-1-carboxamide |
| SMILES | O=C1c2ccccc2C(=O)c2c(NC(=O)C3CC3c3ccccc3)cccc21 |
| InChI | InChI=1S/C24H17NO3/c26-22-15-9-4-5-10-16(15)23(27)21-17(22)11-6-12-20(21)25-24(28)19-13-18(19)14-7-2-1-3-8-14/h1-12,18-19H,13H2,(H,25,28) |
| InChIKey | BNXLBOWVKAWRFH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|