C22H20N2O4 — CID 108792195
1-acetyl-N-(9,10-dioxoanthracen-1-yl)piperidine-4-carboxamide (PubChem CID 108792195) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 1-acetyl-N-(9,10-dioxoanthracen-1-yl)piperidine-4-carboxamide.
| Compound Name | 1-acetyl-N-(9,10-dioxoanthracen-1-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 108792195 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 1-acetyl-N-(9,10-dioxoanthracen-1-yl)piperidine-4-carboxamide |
| SMILES | CC(=O)N1CCC(C(=O)Nc2cccc3c2C(=O)c2ccccc2C3=O)CC1 |
| InChI | InChI=1S/C22H20N2O4/c1-13(25)24-11-9-14(10-12-24)22(28)23-18-8-4-7-17-19(18)21(27)16-6-3-2-5-15(16)20(17)26/h2-8,14H,9-12H2,1H3,(H,23,28) |
| InChIKey | SEGPJMQBGQBVQP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|