C21H20N2O3 — CID 154102442
N-(5-amino-9,10-dioxoanthracen-1-yl)cyclohexanecarboxamide (PubChem CID 154102442) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is N-(5-amino-9,10-dioxoanthracen-1-yl)cyclohexanecarboxamide.
| Compound Name | N-(5-amino-9,10-dioxoanthracen-1-yl)cyclohexanecarboxamide |
|---|---|
| PubChem CID | 154102442 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-(5-amino-9,10-dioxoanthracen-1-yl)cyclohexanecarboxamide |
| SMILES | Nc1cccc2c1C(=O)c1cccc(NC(=O)C3CCCCC3)c1C2=O |
| InChI | InChI=1S/C21H20N2O3/c22-15-10-4-8-13-17(15)19(24)14-9-5-11-16(18(14)20(13)25)23-21(26)12-6-2-1-3-7-12/h4-5,8-12H,1-3,6-7,22H2,(H,23,26) |
| InChIKey | MIRGIHSWTSRWKR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|