About N-(5-amino-9,10-dioxoanthracen-1-yl)cyclohexanecarboxamide
N-(5-amino-9,10-dioxoanthracen-1-yl)cyclohexanecarboxamide (PubChem CID 154102442) has the molecular formula C21H20N2O3
and a molecular weight of 348.40 g/mol. Its IUPAC name is N-(5-amino-9,10-dioxoanthracen-1-yl)cyclohexanecarboxamide.
Molecular Properties
| Compound Name | N-(5-amino-9,10-dioxoanthracen-1-yl)cyclohexanecarboxamide |
| PubChem CID | 154102442 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-(5-amino-9,10-dioxoanthracen-1-yl)cyclohexanecarboxamide |
| SMILES | Nc1cccc2c1C(=O)c1cccc(NC(=O)C3CCCCC3)c1C2=O |
| InChI | InChI=1S/C21H20N2O3/c22-15-10-4-8-13-17(15)19(24)14-9-5-11-16(18(14)20(13)25)23-21(26)12-6-2-1-3-7-12/h4-5,8-12H,1-3,6-7,22H2,(H,23,26) |
| InChIKey | MIRGIHSWTSRWKR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-(5-amino-9,10-dioxoanthracen-1-yl)cyclohexanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-amino-9,10-dioxoanthracen-1-yl)cyclohexanecarboxamide?
The IUPAC name of N-(5-amino-9,10-dioxoanthracen-1-yl)cyclohexanecarboxamide (CID 154102442) is N-(5-amino-9,10-dioxoanthracen-1-yl)cyclohexanecarboxamide.
What is the SMILES notation for N-(5-amino-9,10-dioxoanthracen-1-yl)cyclohexanecarboxamide?
The canonical SMILES for N-(5-amino-9,10-dioxoanthracen-1-yl)cyclohexanecarboxamide is Nc1cccc2c1C(=O)c1cccc(NC(=O)C3CCCCC3)c1C2=O.
What is the InChIKey of N-(5-amino-9,10-dioxoanthracen-1-yl)cyclohexanecarboxamide?
The InChIKey is MIRGIHSWTSRWKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O3/c22-15-10-4-8-13-17(15)19(24)14-9-5-11-16(18(14)20(13)25)23-21(26)12-6-2-1-3-7-12/h4-5,8-12H,1-3,6-7,22H2,(H,23,26).
What are the key properties of N-(5-amino-9,10-dioxoanthracen-1-yl)cyclohexanecarboxamide?
N-(5-amino-9,10-dioxoanthracen-1-yl)cyclohexanecarboxamide has a molecular weight of 348.40 g/mol, XLogP of 3.56, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-amino-9,10-dioxoanthracen-1-yl)cyclohexanecarboxamide is sourced from PubChem (CID 154102442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).