C21H20N2O3 — CID 5011815
1-cyclohexyl-3-(9,10-dioxoanthracen-1-yl)urea (PubChem CID 5011815) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is 1-cyclohexyl-3-(9,10-dioxoanthracen-1-yl)urea.
| Compound Name | 1-cyclohexyl-3-(9,10-dioxoanthracen-1-yl)urea |
|---|---|
| PubChem CID | 5011815 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 1-cyclohexyl-3-(9,10-dioxoanthracen-1-yl)urea |
| SMILES | O=C(Nc1cccc2c1C(=O)c1ccccc1C2=O)NC1CCCCC1 |
| InChI | InChI=1S/C21H20N2O3/c24-19-14-9-4-5-10-15(14)20(25)18-16(19)11-6-12-17(18)23-21(26)22-13-7-2-1-3-8-13/h4-6,9-13H,1-3,7-8H2,(H2,22,23,26) |
| InChIKey | KAAIBWXYIIYHCP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|