C17H18N2O — CID 115617882
1-cyclobutyl-3-(2-phenylphenyl)urea (PubChem CID 115617882) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-cyclobutyl-3-(2-phenylphenyl)urea.
| Compound Name | 1-cyclobutyl-3-(2-phenylphenyl)urea |
|---|---|
| PubChem CID | 115617882 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 1-cyclobutyl-3-(2-phenylphenyl)urea |
| SMILES | O=C(Nc1ccccc1-c1ccccc1)NC1CCC1 |
| InChI | InChI=1S/C17H18N2O/c20-17(18-14-9-6-10-14)19-16-12-5-4-11-15(16)13-7-2-1-3-8-13/h1-5,7-8,11-12,14H,6,9-10H2,(H2,18,19,20) |
| InChIKey | TVTWXQPGRICPPN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |