C16H10F3NO2 — CID 154105166
1-(2,2,2-trifluoroethylamino)anthracene-9,10-dione (PubChem CID 154105166) has the molecular formula C16H10F3NO2 and a molecular weight of 305.26 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethylamino)anthracene-9,10-dione.
| Compound Name | 1-(2,2,2-trifluoroethylamino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 154105166 |
| Molecular Formula | C16H10F3NO2 |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 1-(2,2,2-trifluoroethylamino)anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(NCC(F)(F)F)cccc21 |
| InChI | InChI=1S/C16H10F3NO2/c17-16(18,19)8-20-12-7-3-6-11-13(12)15(22)10-5-2-1-4-9(10)14(11)21/h1-7,20H,8H2 |
| InChIKey | XJYYUOGDYJKKGW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|