C14H10N2O2 — CID 8513
1,5-diaminoanthracene-9,10-dione (PubChem CID 8513) has the molecular formula C14H10N2O2 and a molecular weight of 238.25 g/mol. Its IUPAC name is 1,5-diaminoanthracene-9,10-dione.
| Compound Name | 1,5-diaminoanthracene-9,10-dione |
|---|---|
| PubChem CID | 8513 |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 1,5-diaminoanthracene-9,10-dione |
| SMILES | Nc1cccc2c1C(=O)c1cccc(N)c1C2=O |
| InChI | InChI=1S/C14H10N2O2/c15-9-5-1-3-7-11(9)14(18)8-4-2-6-10(16)12(8)13(7)17/h1-6H,15-16H2 |
| InChIKey | VWBVCOPVKXNMMZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|