C13H10Cl2O2 — CID 125480132
2,3-bis(chloromethyl)-5-methylnaphthalene-1,4-dione (PubChem CID 125480132) has the molecular formula C13H10Cl2O2 and a molecular weight of 269.13 g/mol. Its IUPAC name is 2,3-bis(chloromethyl)-5-methylnaphthalene-1,4-dione.
| Compound Name | 2,3-bis(chloromethyl)-5-methylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 125480132 |
| Molecular Formula | C13H10Cl2O2 |
| Molecular Weight | 269.13 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 2,3-bis(chloromethyl)-5-methylnaphthalene-1,4-dione |
| SMILES | Cc1cccc2c1C(=O)C(CCl)=C(CCl)C2=O |
| InChI | InChI=1S/C13H10Cl2O2/c1-7-3-2-4-8-11(7)13(17)10(6-15)9(5-14)12(8)16/h2-4H,5-6H2,1H3 |
| InChIKey | WAPRTZDPCUGCNK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.13 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|