C16H11ClO2 — CID 141467229
5-chloro-1,4-dimethylanthracene-9,10-dione (PubChem CID 141467229) has the molecular formula C16H11ClO2 and a molecular weight of 270.71 g/mol. Its IUPAC name is 5-chloro-1,4-dimethylanthracene-9,10-dione.
| Compound Name | 5-chloro-1,4-dimethylanthracene-9,10-dione |
|---|---|
| PubChem CID | 141467229 |
| Molecular Formula | C16H11ClO2 |
| Molecular Weight | 270.71 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 5-chloro-1,4-dimethylanthracene-9,10-dione |
| SMILES | Cc1ccc(C)c2c1C(=O)c1cccc(Cl)c1C2=O |
| InChI | InChI=1S/C16H11ClO2/c1-8-6-7-9(2)13-12(8)15(18)10-4-3-5-11(17)14(10)16(13)19/h3-7H,1-2H3 |
| InChIKey | OSKLKLLHIDITGY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.71 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|