C32H24O4 — CID 158117057
1,4-dimethylanthracene-9,10-dione;2,3-dimethylanthracene-9,10-dione (PubChem CID 158117057) has the molecular formula C32H24O4 and a molecular weight of 472.54 g/mol. Its IUPAC name is 1,4-dimethylanthracene-9,10-dione;2,3-dimethylanthracene-9,10-dione.
| Compound Name | 1,4-dimethylanthracene-9,10-dione;2,3-dimethylanthracene-9,10-dione |
|---|---|
| PubChem CID | 158117057 |
| Molecular Formula | C32H24O4 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 1,4-dimethylanthracene-9,10-dione;2,3-dimethylanthracene-9,10-dione |
| SMILES | Cc1cc2c(cc1C)C(=O)c1ccccc1C2=O.Cc1ccc(C)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/2C16H12O2/c1-9-7-13-14(8-10(9)2)16(18)12-6-4-3-5-11(12)15(13)17;1-9-7-8-10(2)14-13(9)15(17)11-5-3-4-6-12(11)16(14)18/h2*3-8H,1-2H3 |
| InChIKey | FRDHUZNCFBEESI-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|