C15H11NO2 — CID 15716485
3-amino-1-methylanthracene-9,10-dione (PubChem CID 15716485) has the molecular formula C15H11NO2 and a molecular weight of 237.26 g/mol. Its IUPAC name is 3-amino-1-methylanthracene-9,10-dione.
| Compound Name | 3-amino-1-methylanthracene-9,10-dione |
|---|---|
| PubChem CID | 15716485 |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 3-amino-1-methylanthracene-9,10-dione |
| SMILES | Cc1cc(N)cc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C15H11NO2/c1-8-6-9(16)7-12-13(8)15(18)11-5-3-2-4-10(11)14(12)17/h2-7H,16H2,1H3 |
| InChIKey | OFZNCXFEPSYYPS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|