C19H11NO3 — CID 101485547
3-phenyl-2H-benzo[g]isoquinoline-1,5,10-trione (PubChem CID 101485547) has the molecular formula C19H11NO3 and a molecular weight of 301.30 g/mol. Its IUPAC name is 3-phenyl-2H-benzo[g]isoquinoline-1,5,10-trione.
| Compound Name | 3-phenyl-2H-benzo[g]isoquinoline-1,5,10-trione |
|---|---|
| PubChem CID | 101485547 |
| Molecular Formula | C19H11NO3 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 3-phenyl-2H-benzo[g]isoquinoline-1,5,10-trione |
| SMILES | O=C1c2ccccc2C(=O)c2c1cc(-c1ccccc1)[nH]c2=O |
| InChI | InChI=1S/C19H11NO3/c21-17-12-8-4-5-9-13(12)18(22)16-14(17)10-15(20-19(16)23)11-6-2-1-3-7-11/h1-10H,(H,20,23) |
| InChIKey | CGKHZWBDRXLJNB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|