C18H13NO3 — CID 134324247
2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid (PubChem CID 134324247) has the molecular formula C18H13NO3 and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid.
| Compound Name | 2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 134324247 |
| Molecular Formula | C18H13NO3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1c(-c2ccccc2)cc(-c2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C18H13NO3/c20-17-16(18(21)22)14(12-7-3-1-4-8-12)11-15(19-17)13-9-5-2-6-10-13/h1-11H,(H,19,20)(H,21,22) |
| InChIKey | MGBAIPQCIDFEAY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |