About 2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid
2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid (PubChem CID 134324247) has the molecular formula C18H13NO3
and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid |
| PubChem CID | 134324247 |
| Molecular Formula | C18H13NO3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1c(-c2ccccc2)cc(-c2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C18H13NO3/c20-17-16(18(21)22)14(12-7-3-1-4-8-12)11-15(19-17)13-9-5-2-6-10-13/h1-11H,(H,19,20)(H,21,22) |
| InChIKey | MGBAIPQCIDFEAY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid?
The IUPAC name of 2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid (CID 134324247) is 2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid.
What is the SMILES notation for 2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid?
The canonical SMILES for 2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid is O=C(O)c1c(-c2ccccc2)cc(-c2ccccc2)[nH]c1=O.
What is the InChIKey of 2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid?
The InChIKey is MGBAIPQCIDFEAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13NO3/c20-17-16(18(21)22)14(12-7-3-1-4-8-12)11-15(19-17)13-9-5-2-6-10-13/h1-11H,(H,19,20)(H,21,22).
What are the key properties of 2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid?
2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid has a molecular weight of 291.31 g/mol, XLogP of 3.41, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid is sourced from PubChem (CID 134324247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).