5-bromo-2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid

C18H12BrNO3 — CID 134330987

IUPAC5-bromo-2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid
SMILESO=C(O)c1c(-c2ccccc2)c(Br)c(-c2ccccc2)[nH]c1=O
InChIInChI=1S/C18H12BrNO3/c19-15-13(11-7-3-1-4-8-11)14(18(22)23)17(21)20-16(15)12-9-5-2-6-10-12/h1-10H,(H,20,21)(H,22,23)
InChIKeyHGJIUIMRNGEACB-UHFFFAOYSA-N
MW370.20 g/mol
LogP4.17
Rot. Bonds3

About 5-bromo-2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid

5-bromo-2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid (PubChem CID 134330987) has the molecular formula C18H12BrNO3 and a molecular weight of 370.20 g/mol. Its IUPAC name is 5-bromo-2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid.

Molecular Properties

Compound Name5-bromo-2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid
PubChem CID134330987
Molecular FormulaC18H12BrNO3
Molecular Weight370.20 g/mol
Exact Mass369.00
IUPAC Name5-bromo-2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid
SMILESO=C(O)c1c(-c2ccccc2)c(Br)c(-c2ccccc2)[nH]c1=O
InChIInChI=1S/C18H12BrNO3/c19-15-13(11-7-3-1-4-8-11)14(18(22)23)17(21)20-16(15)12-9-5-2-6-10-12/h1-10H,(H,20,21)(H,22,23)
InChIKeyHGJIUIMRNGEACB-UHFFFAOYSA-N
XLogP4.17
TPSA70.16 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500370.20
LogP ≤ 54.17
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 5-bromo-2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-bromo-2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid?
The IUPAC name of 5-bromo-2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid (CID 134330987) is 5-bromo-2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid.
What is the SMILES notation for 5-bromo-2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid?
The canonical SMILES for 5-bromo-2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid is O=C(O)c1c(-c2ccccc2)c(Br)c(-c2ccccc2)[nH]c1=O.
What is the InChIKey of 5-bromo-2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid?
The InChIKey is HGJIUIMRNGEACB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12BrNO3/c19-15-13(11-7-3-1-4-8-11)14(18(22)23)17(21)20-16(15)12-9-5-2-6-10-12/h1-10H,(H,20,21)(H,22,23).
What are the key properties of 5-bromo-2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid?
5-bromo-2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid has a molecular weight of 370.20 g/mol, XLogP of 4.17, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-oxo-4,6-diphenyl-1H-pyridine-3-carboxylic acid is sourced from PubChem (CID 134330987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).