C18H13N3O5 — CID 169405410
2-amino-6-oxo-4-(3-pyridin-3-ylphenyl)-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169405410) has the molecular formula C18H13N3O5 and a molecular weight of 351.32 g/mol. Its IUPAC name is 2-amino-6-oxo-4-(3-pyridin-3-ylphenyl)-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-6-oxo-4-(3-pyridin-3-ylphenyl)-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169405410 |
| Molecular Formula | C18H13N3O5 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 2-amino-6-oxo-4-(3-pyridin-3-ylphenyl)-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | Nc1[nH]c(=O)c(C(=O)O)c(-c2cccc(-c3cccnc3)c2)c1C(=O)O |
| InChI | InChI=1S/C18H13N3O5/c19-15-13(17(23)24)12(14(18(25)26)16(22)21-15)10-4-1-3-9(7-10)11-5-2-6-20-8-11/h1-8H,(H,23,24)(H,25,26)(H3,19,21,22) |
| InChIKey | DGIIQFDVBQLHDW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 146.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |