C13H8ClIN2O5 — CID 169407864
2-amino-4-(3-chloro-4-iodophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169407864) has the molecular formula C13H8ClIN2O5 and a molecular weight of 434.57 g/mol. Its IUPAC name is 2-amino-4-(3-chloro-4-iodophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-(3-chloro-4-iodophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169407864 |
| Molecular Formula | C13H8ClIN2O5 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 433.92 |
| IUPAC Name | 2-amino-4-(3-chloro-4-iodophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | Nc1[nH]c(=O)c(C(=O)O)c(-c2ccc(I)c(Cl)c2)c1C(=O)O |
| InChI | InChI=1S/C13H8ClIN2O5/c14-5-3-4(1-2-6(5)15)7-8(12(19)20)10(16)17-11(18)9(7)13(21)22/h1-3H,(H,19,20)(H,21,22)(H3,16,17,18) |
| InChIKey | ZPCIIVPJTGSCRD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 133.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|