C13H6ClF3N2O5 — CID 169407583
2-amino-4-(4-chloro-2,3,6-trifluorophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169407583) has the molecular formula C13H6ClF3N2O5 and a molecular weight of 362.65 g/mol. Its IUPAC name is 2-amino-4-(4-chloro-2,3,6-trifluorophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-(4-chloro-2,3,6-trifluorophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169407583 |
| Molecular Formula | C13H6ClF3N2O5 |
| Molecular Weight | 362.65 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | 2-amino-4-(4-chloro-2,3,6-trifluorophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | Nc1[nH]c(=O)c(C(=O)O)c(-c2c(F)cc(Cl)c(F)c2F)c1C(=O)O |
| InChI | InChI=1S/C13H6ClF3N2O5/c14-2-1-3(15)4(9(17)8(2)16)5-6(12(21)22)10(18)19-11(20)7(5)13(23)24/h1H,(H,21,22)(H,23,24)(H3,18,19,20) |
| InChIKey | BUMPCHUGAITMLH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 133.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.65 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|