C19H12N4O10 — CID 169406905
2-amino-4-[3-(2,4-dinitrophenoxy)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169406905) has the molecular formula C19H12N4O10 and a molecular weight of 456.32 g/mol. Its IUPAC name is 2-amino-4-[3-(2,4-dinitrophenoxy)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-[3-(2,4-dinitrophenoxy)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169406905 |
| Molecular Formula | C19H12N4O10 |
| Molecular Weight | 456.32 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | 2-amino-4-[3-(2,4-dinitrophenoxy)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | Nc1[nH]c(=O)c(C(=O)O)c(-c2cccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c2)c1C(=O)O |
| InChI | InChI=1S/C19H12N4O10/c20-16-14(18(25)26)13(15(19(27)28)17(24)21-16)8-2-1-3-10(6-8)33-12-5-4-9(22(29)30)7-11(12)23(31)32/h1-7H,(H,25,26)(H,27,28)(H3,20,21,24) |
| InChIKey | BQVAWMLMVWANSU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 228.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|