C17H13N5O8 — CID 169407119
2-amino-4-[3-[(3-nitropyrazol-1-yl)methoxy]phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169407119) has the molecular formula C17H13N5O8 and a molecular weight of 415.32 g/mol. Its IUPAC name is 2-amino-4-[3-[(3-nitropyrazol-1-yl)methoxy]phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-[3-[(3-nitropyrazol-1-yl)methoxy]phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169407119 |
| Molecular Formula | C17H13N5O8 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 2-amino-4-[3-[(3-nitropyrazol-1-yl)methoxy]phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | Nc1[nH]c(=O)c(C(=O)O)c(-c2cccc(OCn3ccc([N+](=O)[O-])n3)c2)c1C(=O)O |
| InChI | InChI=1S/C17H13N5O8/c18-14-12(16(24)25)11(13(17(26)27)15(23)19-14)8-2-1-3-9(6-8)30-7-21-5-4-10(20-21)22(28)29/h1-6H,7H2,(H,24,25)(H,26,27)(H3,18,19,23) |
| InChIKey | VPZQIXGVJWBXKN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 203.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|