C13H11N7O4 — CID 169404108
5-[3-[(3-nitropyrazol-1-yl)methoxy]phenyl]-2H-triazole-4-carboxamide (PubChem CID 169404108) has the molecular formula C13H11N7O4 and a molecular weight of 329.28 g/mol. Its IUPAC name is 5-[3-[(3-nitropyrazol-1-yl)methoxy]phenyl]-2H-triazole-4-carboxamide.
| Compound Name | 5-[3-[(3-nitropyrazol-1-yl)methoxy]phenyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169404108 |
| Molecular Formula | C13H11N7O4 |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 5-[3-[(3-nitropyrazol-1-yl)methoxy]phenyl]-2H-triazole-4-carboxamide |
| SMILES | NC(=O)c1n[nH]nc1-c1cccc(OCn2ccc([N+](=O)[O-])n2)c1 |
| InChI | InChI=1S/C13H11N7O4/c14-13(21)12-11(15-18-16-12)8-2-1-3-9(6-8)24-7-19-5-4-10(17-19)20(22)23/h1-6H,7H2,(H2,14,21)(H,15,16,18) |
| InChIKey | OBOKTWCDKXUIBK-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 154.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|