C13H14N4O4 — CID 169402542
5-[3-(1,3-dioxolan-2-ylmethoxy)phenyl]-2H-triazole-4-carboxamide (PubChem CID 169402542) has the molecular formula C13H14N4O4 and a molecular weight of 290.28 g/mol. Its IUPAC name is 5-[3-(1,3-dioxolan-2-ylmethoxy)phenyl]-2H-triazole-4-carboxamide.
| Compound Name | 5-[3-(1,3-dioxolan-2-ylmethoxy)phenyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169402542 |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 5-[3-(1,3-dioxolan-2-ylmethoxy)phenyl]-2H-triazole-4-carboxamide |
| SMILES | NC(=O)c1n[nH]nc1-c1cccc(OCC2OCCO2)c1 |
| InChI | InChI=1S/C13H14N4O4/c14-13(18)12-11(15-17-16-12)8-2-1-3-9(6-8)21-7-10-19-4-5-20-10/h1-3,6,10H,4-5,7H2,(H2,14,18)(H,15,16,17) |
| InChIKey | WHFAMWFYJOPZLR-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 112.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |