C20H22N4O4 — CID 169402978
5-[3-[(3,4-diethoxyphenyl)methoxy]phenyl]-2H-triazole-4-carboxamide (PubChem CID 169402978) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is 5-[3-[(3,4-diethoxyphenyl)methoxy]phenyl]-2H-triazole-4-carboxamide.
| Compound Name | 5-[3-[(3,4-diethoxyphenyl)methoxy]phenyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169402978 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 5-[3-[(3,4-diethoxyphenyl)methoxy]phenyl]-2H-triazole-4-carboxamide |
| SMILES | CCOc1ccc(COc2cccc(-c3n[nH]nc3C(N)=O)c2)cc1OCC |
| InChI | InChI=1S/C20H22N4O4/c1-3-26-16-9-8-13(10-17(16)27-4-2)12-28-15-7-5-6-14(11-15)18-19(20(21)25)23-24-22-18/h5-11H,3-4,12H2,1-2H3,(H2,21,25)(H,22,23,24) |
| InChIKey | ZKIONMFKXBUFED-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 112.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |