C23H21N5O4 — CID 169403992
5-[3-ethoxy-4-[2-(naphthalen-1-ylamino)-2-oxoethoxy]phenyl]-2H-triazole-4-carboxamide (PubChem CID 169403992) has the molecular formula C23H21N5O4 and a molecular weight of 431.45 g/mol. Its IUPAC name is 5-[3-ethoxy-4-[2-(naphthalen-1-ylamino)-2-oxoethoxy]phenyl]-2H-triazole-4-carboxamide.
| Compound Name | 5-[3-ethoxy-4-[2-(naphthalen-1-ylamino)-2-oxoethoxy]phenyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169403992 |
| Molecular Formula | C23H21N5O4 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 5-[3-ethoxy-4-[2-(naphthalen-1-ylamino)-2-oxoethoxy]phenyl]-2H-triazole-4-carboxamide |
| SMILES | CCOc1cc(-c2n[nH]nc2C(N)=O)ccc1OCC(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C23H21N5O4/c1-2-31-19-12-15(21-22(23(24)30)27-28-26-21)10-11-18(19)32-13-20(29)25-17-9-5-7-14-6-3-4-8-16(14)17/h3-12H,2,13H2,1H3,(H2,24,30)(H,25,29)(H,26,27,28) |
| InChIKey | SVMFZSAEFOLVHG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 132.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |