C21H22N4O6 — CID 169400039
ethyl 5-[3-methoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]-2H-triazole-4-carboxylate (PubChem CID 169400039) has the molecular formula C21H22N4O6 and a molecular weight of 426.43 g/mol. Its IUPAC name is ethyl 5-[3-methoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-[3-methoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169400039 |
| Molecular Formula | C21H22N4O6 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | ethyl 5-[3-methoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1ccc(OCC(=O)Nc2ccc(OC)cc2)c(OC)c1 |
| InChI | InChI=1S/C21H22N4O6/c1-4-30-21(27)20-19(23-25-24-20)13-5-10-16(17(11-13)29-3)31-12-18(26)22-14-6-8-15(28-2)9-7-14/h5-11H,4,12H2,1-3H3,(H,22,26)(H,23,24,25) |
| InChIKey | SQOGPEOKMWQHAB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |