C20H19BrN4O4 — CID 169401104
ethyl 5-[5-bromo-2-[2-(4-methylanilino)-2-oxoethoxy]phenyl]-2H-triazole-4-carboxylate (PubChem CID 169401104) has the molecular formula C20H19BrN4O4 and a molecular weight of 459.30 g/mol. Its IUPAC name is ethyl 5-[5-bromo-2-[2-(4-methylanilino)-2-oxoethoxy]phenyl]-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-[5-bromo-2-[2-(4-methylanilino)-2-oxoethoxy]phenyl]-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169401104 |
| Molecular Formula | C20H19BrN4O4 |
| Molecular Weight | 459.30 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | ethyl 5-[5-bromo-2-[2-(4-methylanilino)-2-oxoethoxy]phenyl]-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1cc(Br)ccc1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C20H19BrN4O4/c1-3-28-20(27)19-18(23-25-24-19)15-10-13(21)6-9-16(15)29-11-17(26)22-14-7-4-12(2)5-8-14/h4-10H,3,11H2,1-2H3,(H,22,26)(H,23,24,25) |
| InChIKey | GMMJPCIEECGCGS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.30 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |