C21H22N4O5 — CID 169400026
ethyl 5-[3-methoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]-2H-triazole-4-carboxylate (PubChem CID 169400026) has the molecular formula C21H22N4O5 and a molecular weight of 410.43 g/mol. Its IUPAC name is ethyl 5-[3-methoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-[3-methoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169400026 |
| Molecular Formula | C21H22N4O5 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | ethyl 5-[3-methoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1ccc(OCC(=O)Nc2ccc(C)cc2)c(OC)c1 |
| InChI | InChI=1S/C21H22N4O5/c1-4-29-21(27)20-19(23-25-24-20)14-7-10-16(17(11-14)28-3)30-12-18(26)22-15-8-5-13(2)6-9-15/h5-11H,4,12H2,1-3H3,(H,22,26)(H,23,24,25) |
| InChIKey | DVKNGFYXUBXXFR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |