C19H19N5O4 — CID 169403022
5-[3-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]-2H-triazole-4-carboxamide (PubChem CID 169403022) has the molecular formula C19H19N5O4 and a molecular weight of 381.39 g/mol. Its IUPAC name is 5-[3-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]-2H-triazole-4-carboxamide.
| Compound Name | 5-[3-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169403022 |
| Molecular Formula | C19H19N5O4 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 5-[3-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]-2H-triazole-4-carboxamide |
| SMILES | COc1cc(-c2n[nH]nc2C(N)=O)ccc1OCC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C19H19N5O4/c1-11-5-3-4-6-13(11)21-16(25)10-28-14-8-7-12(9-15(14)27-2)17-18(19(20)26)23-24-22-17/h3-9H,10H2,1-2H3,(H2,20,26)(H,21,25)(H,22,23,24) |
| InChIKey | RDVYMQYYMNWGMG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 132.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |