C18H18N4O3 — CID 169402819
5-[4-methoxy-3-[(2-methylphenoxy)methyl]phenyl]-2H-triazole-4-carboxamide (PubChem CID 169402819) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is 5-[4-methoxy-3-[(2-methylphenoxy)methyl]phenyl]-2H-triazole-4-carboxamide.
| Compound Name | 5-[4-methoxy-3-[(2-methylphenoxy)methyl]phenyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169402819 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 5-[4-methoxy-3-[(2-methylphenoxy)methyl]phenyl]-2H-triazole-4-carboxamide |
| SMILES | COc1ccc(-c2n[nH]nc2C(N)=O)cc1COc1ccccc1C |
| InChI | InChI=1S/C18H18N4O3/c1-11-5-3-4-6-14(11)25-10-13-9-12(7-8-15(13)24-2)16-17(18(19)23)21-22-20-16/h3-9H,10H2,1-2H3,(H2,19,23)(H,20,21,22) |
| InChIKey | SCDHJABNCQWUOT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |