C19H18ClN3O4 — CID 169400372
ethyl 5-[3-[(2-chlorophenyl)methoxy]-4-methoxyphenyl]-2H-triazole-4-carboxylate (PubChem CID 169400372) has the molecular formula C19H18ClN3O4 and a molecular weight of 387.82 g/mol. Its IUPAC name is ethyl 5-[3-[(2-chlorophenyl)methoxy]-4-methoxyphenyl]-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-[3-[(2-chlorophenyl)methoxy]-4-methoxyphenyl]-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169400372 |
| Molecular Formula | C19H18ClN3O4 |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | ethyl 5-[3-[(2-chlorophenyl)methoxy]-4-methoxyphenyl]-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1ccc(OC)c(OCc2ccccc2Cl)c1 |
| InChI | InChI=1S/C19H18ClN3O4/c1-3-26-19(24)18-17(21-23-22-18)12-8-9-15(25-2)16(10-12)27-11-13-6-4-5-7-14(13)20/h4-10H,3,11H2,1-2H3,(H,21,22,23) |
| InChIKey | LHQDYXHQYPFTIT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |