C20H20N4O5 — CID 169399837
ethyl 5-[3-[(2-carbamoylphenoxy)methyl]-4-methoxyphenyl]-2H-triazole-4-carboxylate (PubChem CID 169399837) has the molecular formula C20H20N4O5 and a molecular weight of 396.40 g/mol. Its IUPAC name is ethyl 5-[3-[(2-carbamoylphenoxy)methyl]-4-methoxyphenyl]-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-[3-[(2-carbamoylphenoxy)methyl]-4-methoxyphenyl]-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169399837 |
| Molecular Formula | C20H20N4O5 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | ethyl 5-[3-[(2-carbamoylphenoxy)methyl]-4-methoxyphenyl]-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1ccc(OC)c(COc2ccccc2C(N)=O)c1 |
| InChI | InChI=1S/C20H20N4O5/c1-3-28-20(26)18-17(22-24-23-18)12-8-9-15(27-2)13(10-12)11-29-16-7-5-4-6-14(16)19(21)25/h4-10H,3,11H2,1-2H3,(H2,21,25)(H,22,23,24) |
| InChIKey | XHJGDEQLONTXNX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 129.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |