C13H10N4O2 — CID 169402380
5-[3-(furan-2-yl)phenyl]-2H-triazole-4-carboxamide (PubChem CID 169402380) has the molecular formula C13H10N4O2 and a molecular weight of 254.25 g/mol. Its IUPAC name is 5-[3-(furan-2-yl)phenyl]-2H-triazole-4-carboxamide.
| Compound Name | 5-[3-(furan-2-yl)phenyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169402380 |
| Molecular Formula | C13H10N4O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 5-[3-(furan-2-yl)phenyl]-2H-triazole-4-carboxamide |
| SMILES | NC(=O)c1n[nH]nc1-c1cccc(-c2ccco2)c1 |
| InChI | InChI=1S/C13H10N4O2/c14-13(18)12-11(15-17-16-12)9-4-1-3-8(7-9)10-5-2-6-19-10/h1-7H,(H2,14,18)(H,15,16,17) |
| InChIKey | OPFYDBDRRSNKQA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |