C14H14N4O2 — CID 169404378
5-(2,2-dimethylchromen-6-yl)-2H-triazole-4-carboxamide (PubChem CID 169404378) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is 5-(2,2-dimethylchromen-6-yl)-2H-triazole-4-carboxamide.
| Compound Name | 5-(2,2-dimethylchromen-6-yl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169404378 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 5-(2,2-dimethylchromen-6-yl)-2H-triazole-4-carboxamide |
| SMILES | CC1(C)C=Cc2cc(-c3n[nH]nc3C(N)=O)ccc2O1 |
| InChI | InChI=1S/C14H14N4O2/c1-14(2)6-5-8-7-9(3-4-10(8)20-14)11-12(13(15)19)17-18-16-11/h3-7H,1-2H3,(H2,15,19)(H,16,17,18) |
| InChIKey | BGJOYYBZCNGJHQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |