C14H13N7O4 — CID 169403843
5-[2-[(5-methyl-3-nitropyrazol-1-yl)methoxy]phenyl]-2H-triazole-4-carboxamide (PubChem CID 169403843) has the molecular formula C14H13N7O4 and a molecular weight of 343.30 g/mol. Its IUPAC name is 5-[2-[(5-methyl-3-nitropyrazol-1-yl)methoxy]phenyl]-2H-triazole-4-carboxamide.
| Compound Name | 5-[2-[(5-methyl-3-nitropyrazol-1-yl)methoxy]phenyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169403843 |
| Molecular Formula | C14H13N7O4 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 5-[2-[(5-methyl-3-nitropyrazol-1-yl)methoxy]phenyl]-2H-triazole-4-carboxamide |
| SMILES | Cc1cc([N+](=O)[O-])nn1COc1ccccc1-c1n[nH]nc1C(N)=O |
| InChI | InChI=1S/C14H13N7O4/c1-8-6-11(21(23)24)18-20(8)7-25-10-5-3-2-4-9(10)12-13(14(15)22)17-19-16-12/h2-6H,7H2,1H3,(H2,15,22)(H,16,17,19) |
| InChIKey | HIIIQBXWPAEUHD-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 154.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|