C9H6N6O5 — CID 169402058
5-(2,4-dinitrophenyl)-2H-triazole-4-carboxamide (PubChem CID 169402058) has the molecular formula C9H6N6O5 and a molecular weight of 278.18 g/mol. Its IUPAC name is 5-(2,4-dinitrophenyl)-2H-triazole-4-carboxamide.
| Compound Name | 5-(2,4-dinitrophenyl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169402058 |
| Molecular Formula | C9H6N6O5 |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 5-(2,4-dinitrophenyl)-2H-triazole-4-carboxamide |
| SMILES | NC(=O)c1n[nH]nc1-c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H6N6O5/c10-9(16)8-7(11-13-12-8)5-2-1-4(14(17)18)3-6(5)15(19)20/h1-3H,(H2,10,16)(H,11,12,13) |
| InChIKey | JJHNPXMGMBFJNA-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 170.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|