C10H6N6O3 — CID 169404274
5-(3-cyano-4-nitrophenyl)-2H-triazole-4-carboxamide (PubChem CID 169404274) has the molecular formula C10H6N6O3 and a molecular weight of 258.20 g/mol. Its IUPAC name is 5-(3-cyano-4-nitrophenyl)-2H-triazole-4-carboxamide.
| Compound Name | 5-(3-cyano-4-nitrophenyl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169404274 |
| Molecular Formula | C10H6N6O3 |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 5-(3-cyano-4-nitrophenyl)-2H-triazole-4-carboxamide |
| SMILES | N#Cc1cc(-c2n[nH]nc2C(N)=O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H6N6O3/c11-4-6-3-5(1-2-7(6)16(18)19)8-9(10(12)17)14-15-13-8/h1-3H,(H2,12,17)(H,13,14,15) |
| InChIKey | GTDPAJBRSLOGRP-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 151.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|