C9H7N5O5 — CID 169402791
5-(4,5-dihydroxy-2-nitrophenyl)-2H-triazole-4-carboxamide (PubChem CID 169402791) has the molecular formula C9H7N5O5 and a molecular weight of 265.19 g/mol. Its IUPAC name is 5-(4,5-dihydroxy-2-nitrophenyl)-2H-triazole-4-carboxamide.
| Compound Name | 5-(4,5-dihydroxy-2-nitrophenyl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169402791 |
| Molecular Formula | C9H7N5O5 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 5-(4,5-dihydroxy-2-nitrophenyl)-2H-triazole-4-carboxamide |
| SMILES | NC(=O)c1n[nH]nc1-c1cc(O)c(O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H7N5O5/c10-9(17)8-7(11-13-12-8)3-1-5(15)6(16)2-4(3)14(18)19/h1-2,15-16H,(H2,10,17)(H,11,12,13) |
| InChIKey | RZKFWCJCEROATH-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 168.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|