C11H9N5O7 — CID 169400881
ethyl 5-(2-hydroxy-3,5-dinitrophenyl)-2H-triazole-4-carboxylate (PubChem CID 169400881) has the molecular formula C11H9N5O7 and a molecular weight of 323.22 g/mol. Its IUPAC name is ethyl 5-(2-hydroxy-3,5-dinitrophenyl)-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-(2-hydroxy-3,5-dinitrophenyl)-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169400881 |
| Molecular Formula | C11H9N5O7 |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | ethyl 5-(2-hydroxy-3,5-dinitrophenyl)-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C11H9N5O7/c1-2-23-11(18)9-8(12-14-13-9)6-3-5(15(19)20)4-7(10(6)17)16(21)22/h3-4,17H,2H2,1H3,(H,12,13,14) |
| InChIKey | RFLNOVBYJKWASB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 174.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|