C12H9F3N4O5 — CID 169401461
ethyl 5-[5-nitro-2-(trifluoromethoxy)phenyl]-2H-triazole-4-carboxylate (PubChem CID 169401461) has the molecular formula C12H9F3N4O5 and a molecular weight of 346.22 g/mol. Its IUPAC name is ethyl 5-[5-nitro-2-(trifluoromethoxy)phenyl]-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-[5-nitro-2-(trifluoromethoxy)phenyl]-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169401461 |
| Molecular Formula | C12H9F3N4O5 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | ethyl 5-[5-nitro-2-(trifluoromethoxy)phenyl]-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1cc([N+](=O)[O-])ccc1OC(F)(F)F |
| InChI | InChI=1S/C12H9F3N4O5/c1-2-23-11(20)10-9(16-18-17-10)7-5-6(19(21)22)3-4-8(7)24-12(13,14)15/h3-5H,2H2,1H3,(H,16,17,18) |
| InChIKey | MEJYBEBIWFVSES-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|