C10H8ClF2NO5 — CID 66453060
ethyl 2-(2-chloro-4-nitrophenoxy)-2,2-difluoroacetate (PubChem CID 66453060) has the molecular formula C10H8ClF2NO5 and a molecular weight of 295.63 g/mol. Its IUPAC name is ethyl 2-(2-chloro-4-nitrophenoxy)-2,2-difluoroacetate.
| Compound Name | ethyl 2-(2-chloro-4-nitrophenoxy)-2,2-difluoroacetate |
|---|---|
| PubChem CID | 66453060 |
| Molecular Formula | C10H8ClF2NO5 |
| Molecular Weight | 295.63 g/mol |
| Exact Mass | 295.01 |
| IUPAC Name | ethyl 2-(2-chloro-4-nitrophenoxy)-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)Oc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C10H8ClF2NO5/c1-2-18-9(15)10(12,13)19-8-4-3-6(14(16)17)5-7(8)11/h3-5H,2H2,1H3 |
| InChIKey | KPUHZYDLLIGZCV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.63 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|