C10H7BrF3NO5 — CID 103483106
ethyl 2-(4-bromo-5-fluoro-2-nitrophenoxy)-2,2-difluoroacetate (PubChem CID 103483106) has the molecular formula C10H7BrF3NO5 and a molecular weight of 358.07 g/mol. Its IUPAC name is ethyl 2-(4-bromo-5-fluoro-2-nitrophenoxy)-2,2-difluoroacetate.
| Compound Name | ethyl 2-(4-bromo-5-fluoro-2-nitrophenoxy)-2,2-difluoroacetate |
|---|---|
| PubChem CID | 103483106 |
| Molecular Formula | C10H7BrF3NO5 |
| Molecular Weight | 358.07 g/mol |
| Exact Mass | 356.95 |
| IUPAC Name | ethyl 2-(4-bromo-5-fluoro-2-nitrophenoxy)-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)Oc1cc(F)c(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H7BrF3NO5/c1-2-19-9(16)10(13,14)20-8-4-6(12)5(11)3-7(8)15(17)18/h3-4H,2H2,1H3 |
| InChIKey | GXWUPJPFIIHYBM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.07 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|