C8H5BrF3N3O4 — CID 103484134
2-(4-bromo-5-fluoro-2-nitrophenoxy)-2,2-difluoroacetohydrazide (PubChem CID 103484134) has the molecular formula C8H5BrF3N3O4 and a molecular weight of 344.04 g/mol. Its IUPAC name is 2-(4-bromo-5-fluoro-2-nitrophenoxy)-2,2-difluoroacetohydrazide.
| Compound Name | 2-(4-bromo-5-fluoro-2-nitrophenoxy)-2,2-difluoroacetohydrazide |
|---|---|
| PubChem CID | 103484134 |
| Molecular Formula | C8H5BrF3N3O4 |
| Molecular Weight | 344.04 g/mol |
| Exact Mass | 342.94 |
| IUPAC Name | 2-(4-bromo-5-fluoro-2-nitrophenoxy)-2,2-difluoroacetohydrazide |
| SMILES | NNC(=O)C(F)(F)Oc1cc(F)c(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H5BrF3N3O4/c9-3-1-5(15(17)18)6(2-4(3)10)19-8(11,12)7(16)14-13/h1-2H,13H2,(H,14,16) |
| InChIKey | BUFSNRFMQKHGBD-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.04 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|