C11H11F2NO6 — CID 103201519
ethyl 2,2-difluoro-2-(4-methoxy-3-nitrophenoxy)acetate (PubChem CID 103201519) has the molecular formula C11H11F2NO6 and a molecular weight of 291.21 g/mol. Its IUPAC name is ethyl 2,2-difluoro-2-(4-methoxy-3-nitrophenoxy)acetate.
| Compound Name | ethyl 2,2-difluoro-2-(4-methoxy-3-nitrophenoxy)acetate |
|---|---|
| PubChem CID | 103201519 |
| Molecular Formula | C11H11F2NO6 |
| Molecular Weight | 291.21 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | ethyl 2,2-difluoro-2-(4-methoxy-3-nitrophenoxy)acetate |
| SMILES | CCOC(=O)C(F)(F)Oc1ccc(OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H11F2NO6/c1-3-19-10(15)11(12,13)20-7-4-5-9(18-2)8(6-7)14(16)17/h4-6H,3H2,1-2H3 |
| InChIKey | HROLRXYQMBAFRQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.21 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|