C10H8ClF3O3 — CID 82717095
ethyl 2-(4-chloro-3-fluorophenoxy)-2,2-difluoroacetate (PubChem CID 82717095) has the molecular formula C10H8ClF3O3 and a molecular weight of 268.62 g/mol. Its IUPAC name is ethyl 2-(4-chloro-3-fluorophenoxy)-2,2-difluoroacetate.
| Compound Name | ethyl 2-(4-chloro-3-fluorophenoxy)-2,2-difluoroacetate |
|---|---|
| PubChem CID | 82717095 |
| Molecular Formula | C10H8ClF3O3 |
| Molecular Weight | 268.62 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | ethyl 2-(4-chloro-3-fluorophenoxy)-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)Oc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C10H8ClF3O3/c1-2-16-9(15)10(13,14)17-6-3-4-7(11)8(12)5-6/h3-5H,2H2,1H3 |
| InChIKey | VNPMCGIWGBYUBV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.62 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |