C14H18F2O3 — CID 113322624
ethyl 2-(4-butylphenoxy)-2,2-difluoroacetate (PubChem CID 113322624) has the molecular formula C14H18F2O3 and a molecular weight of 272.29 g/mol. Its IUPAC name is ethyl 2-(4-butylphenoxy)-2,2-difluoroacetate.
| Compound Name | ethyl 2-(4-butylphenoxy)-2,2-difluoroacetate |
|---|---|
| PubChem CID | 113322624 |
| Molecular Formula | C14H18F2O3 |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | ethyl 2-(4-butylphenoxy)-2,2-difluoroacetate |
| SMILES | CCCCc1ccc(OC(F)(F)C(=O)OCC)cc1 |
| InChI | InChI=1S/C14H18F2O3/c1-3-5-6-11-7-9-12(10-8-11)19-14(15,16)13(17)18-4-2/h7-10H,3-6H2,1-2H3 |
| InChIKey | IFVWYUHTNZDJAS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |