C14H11ClF2O3 — CID 66452638
ethyl 2-(4-chloronaphthalen-1-yl)oxy-2,2-difluoroacetate (PubChem CID 66452638) has the molecular formula C14H11ClF2O3 and a molecular weight of 300.69 g/mol. Its IUPAC name is ethyl 2-(4-chloronaphthalen-1-yl)oxy-2,2-difluoroacetate.
| Compound Name | ethyl 2-(4-chloronaphthalen-1-yl)oxy-2,2-difluoroacetate |
|---|---|
| PubChem CID | 66452638 |
| Molecular Formula | C14H11ClF2O3 |
| Molecular Weight | 300.69 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | ethyl 2-(4-chloronaphthalen-1-yl)oxy-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)Oc1ccc(Cl)c2ccccc12 |
| InChI | InChI=1S/C14H11ClF2O3/c1-2-19-13(18)14(16,17)20-12-8-7-11(15)9-5-3-4-6-10(9)12/h3-8H,2H2,1H3 |
| InChIKey | MBCPEZVKBVSPJH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.69 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |