C16H18ClNO2 — CID 112779036
2-(4-chloronaphthalen-1-yl)oxy-N,N-diethylacetamide (PubChem CID 112779036) has the molecular formula C16H18ClNO2 and a molecular weight of 291.78 g/mol. Its IUPAC name is 2-(4-chloronaphthalen-1-yl)oxy-N,N-diethylacetamide.
| Compound Name | 2-(4-chloronaphthalen-1-yl)oxy-N,N-diethylacetamide |
|---|---|
| PubChem CID | 112779036 |
| Molecular Formula | C16H18ClNO2 |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 2-(4-chloronaphthalen-1-yl)oxy-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)COc1ccc(Cl)c2ccccc12 |
| InChI | InChI=1S/C16H18ClNO2/c1-3-18(4-2)16(19)11-20-15-10-9-14(17)12-7-5-6-8-13(12)15/h5-10H,3-4,11H2,1-2H3 |
| InChIKey | YWJFMHAGIMZSLE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |