C23H22N2O2 — CID 172658991
2-[4-(4-cyanophenyl)naphthalen-1-yl]oxy-N,N-diethylacetamide (PubChem CID 172658991) has the molecular formula C23H22N2O2 and a molecular weight of 358.44 g/mol. Its IUPAC name is 2-[4-(4-cyanophenyl)naphthalen-1-yl]oxy-N,N-diethylacetamide.
| Compound Name | 2-[4-(4-cyanophenyl)naphthalen-1-yl]oxy-N,N-diethylacetamide |
|---|---|
| PubChem CID | 172658991 |
| Molecular Formula | C23H22N2O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 2-[4-(4-cyanophenyl)naphthalen-1-yl]oxy-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)COc1ccc(-c2ccc(C#N)cc2)c2ccccc12 |
| InChI | InChI=1S/C23H22N2O2/c1-3-25(4-2)23(26)16-27-22-14-13-19(20-7-5-6-8-21(20)22)18-11-9-17(15-24)10-12-18/h5-14H,3-4,16H2,1-2H3 |
| InChIKey | HUYSRGQNUHGOHU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |