C12H16FNO2 — CID 2178411
N,N-diethyl-2-(2-fluorophenoxy)acetamide (PubChem CID 2178411) has the molecular formula C12H16FNO2 and a molecular weight of 225.26 g/mol. Its IUPAC name is N,N-diethyl-2-(2-fluorophenoxy)acetamide.
| Compound Name | N,N-diethyl-2-(2-fluorophenoxy)acetamide |
|---|---|
| PubChem CID | 2178411 |
| Molecular Formula | C12H16FNO2 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | N,N-diethyl-2-(2-fluorophenoxy)acetamide |
| SMILES | CCN(CC)C(=O)COc1ccccc1F |
| InChI | InChI=1S/C12H16FNO2/c1-3-14(4-2)12(15)9-16-11-8-6-5-7-10(11)13/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | WCOCXFVBVZNEJD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |